C13H9ClN2OS — CID 21298104
4-[(5-chloro-1,3-benzothiazol-2-yl)oxy]aniline (PubChem CID 21298104) has the molecular formula C13H9ClN2OS and a molecular weight of 276.75 g/mol. Its IUPAC name is 4-[(5-chloro-1,3-benzothiazol-2-yl)oxy]aniline.
| Compound Name | 4-[(5-chloro-1,3-benzothiazol-2-yl)oxy]aniline |
|---|---|
| PubChem CID | 21298104 |
| Molecular Formula | C13H9ClN2OS |
| Molecular Weight | 276.75 g/mol |
| Exact Mass | 276.01 |
| IUPAC Name | 4-[(5-chloro-1,3-benzothiazol-2-yl)oxy]aniline |
| SMILES | Nc1ccc(Oc2nc3cc(Cl)ccc3s2)cc1 |
| InChI | InChI=1S/C13H9ClN2OS/c14-8-1-6-12-11(7-8)16-13(18-12)17-10-4-2-9(15)3-5-10/h1-7H,15H2 |
| InChIKey | JJFQNGRYHWENOZ-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.75 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|