C19H22BrN5O2S2 — CID 21300395
1-[4-[[5-bromo-4-(1,3-thiazol-2-ylsulfanyl)pyrimidin-2-yl]amino]phenoxy]-3-(propan-2-ylamino)propan-2-ol (PubChem CID 21300395) has the molecular formula C19H22BrN5O2S2 and a molecular weight of 496.46 g/mol. Its IUPAC name is 1-[4-[[5-bromo-4-(1,3-thiazol-2-ylsulfanyl)pyrimidin-2-yl]amino]phenoxy]-3-(propan-2-ylamino)propan-2-ol.
| Compound Name | 1-[4-[[5-bromo-4-(1,3-thiazol-2-ylsulfanyl)pyrimidin-2-yl]amino]phenoxy]-3-(propan-2-ylamino)propan-2-ol |
|---|---|
| PubChem CID | 21300395 |
| Molecular Formula | C19H22BrN5O2S2 |
| Molecular Weight | 496.46 g/mol |
| Exact Mass | 495.04 |
| IUPAC Name | 1-[4-[[5-bromo-4-(1,3-thiazol-2-ylsulfanyl)pyrimidin-2-yl]amino]phenoxy]-3-(propan-2-ylamino)propan-2-ol |
| SMILES | CC(C)NCC(O)COc1ccc(Nc2ncc(Br)c(Sc3nccs3)n2)cc1 |
| InChI | InChI=1S/C19H22BrN5O2S2/c1-12(2)22-9-14(26)11-27-15-5-3-13(4-6-15)24-18-23-10-16(20)17(25-18)29-19-21-7-8-28-19/h3-8,10,12,14,22,26H,9,11H2,1-2H3,(H,23,24,25) |
| InChIKey | NYYTWYOKFLPEEP-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 92.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.46 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|