C23H27BrN4OS — CID 10277901
5-bromo-N-[4-[3-(tert-butylamino)propoxy]phenyl]-4-phenylsulfanylpyrimidin-2-amine (PubChem CID 10277901) has the molecular formula C23H27BrN4OS and a molecular weight of 487.47 g/mol. Its IUPAC name is 5-bromo-N-[4-[3-(tert-butylamino)propoxy]phenyl]-4-phenylsulfanylpyrimidin-2-amine.
| Compound Name | 5-bromo-N-[4-[3-(tert-butylamino)propoxy]phenyl]-4-phenylsulfanylpyrimidin-2-amine |
|---|---|
| PubChem CID | 10277901 |
| Molecular Formula | C23H27BrN4OS |
| Molecular Weight | 487.47 g/mol |
| Exact Mass | 486.11 |
| IUPAC Name | 5-bromo-N-[4-[3-(tert-butylamino)propoxy]phenyl]-4-phenylsulfanylpyrimidin-2-amine |
| SMILES | CC(C)(C)NCCCOc1ccc(Nc2ncc(Br)c(Sc3ccccc3)n2)cc1 |
| InChI | InChI=1S/C23H27BrN4OS/c1-23(2,3)26-14-7-15-29-18-12-10-17(11-13-18)27-22-25-16-20(24)21(28-22)30-19-8-5-4-6-9-19/h4-6,8-13,16,26H,7,14-15H2,1-3H3,(H,25,27,28) |
| InChIKey | YMORYLKXFLLEGK-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 59.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.47 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|