C25H37Cl2FN2O3 — CID 21300652
1-[2-(4-fluorophenoxy)ethyl]-4-[2-(N-methyl-4-propan-2-yloxyanilino)ethyl]piperidin-4-ol;dihydrochloride (PubChem CID 21300652) has the molecular formula C25H37Cl2FN2O3 and a molecular weight of 503.49 g/mol. Its IUPAC name is 1-[2-(4-fluorophenoxy)ethyl]-4-[2-(N-methyl-4-propan-2-yloxyanilino)ethyl]piperidin-4-ol;dihydrochloride.
| Compound Name | 1-[2-(4-fluorophenoxy)ethyl]-4-[2-(N-methyl-4-propan-2-yloxyanilino)ethyl]piperidin-4-ol;dihydrochloride |
|---|---|
| PubChem CID | 21300652 |
| Molecular Formula | C25H37Cl2FN2O3 |
| Molecular Weight | 503.49 g/mol |
| Exact Mass | 502.22 |
| IUPAC Name | 1-[2-(4-fluorophenoxy)ethyl]-4-[2-(N-methyl-4-propan-2-yloxyanilino)ethyl]piperidin-4-ol;dihydrochloride |
| SMILES | CC(C)Oc1ccc(N(C)CCC2(O)CCN(CCOc3ccc(F)cc3)CC2)cc1.Cl.Cl |
| InChI | InChI=1S/C25H35FN2O3.2ClH/c1-20(2)31-24-10-6-22(7-11-24)27(3)15-12-25(29)13-16-28(17-14-25)18-19-30-23-8-4-21(26)5-9-23;;/h4-11,20,29H,12-19H2,1-3H3;2*1H |
| InChIKey | PMXOINLJYSBEKW-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 45.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.49 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|