C25H38Cl2N2O3 — CID 21300860
4-[2-(N-methyl-4-propan-2-yloxyanilino)ethyl]-1-(2-phenoxyethyl)piperidin-4-ol;dihydrochloride (PubChem CID 21300860) has the molecular formula C25H38Cl2N2O3 and a molecular weight of 485.50 g/mol. Its IUPAC name is 4-[2-(N-methyl-4-propan-2-yloxyanilino)ethyl]-1-(2-phenoxyethyl)piperidin-4-ol;dihydrochloride.
| Compound Name | 4-[2-(N-methyl-4-propan-2-yloxyanilino)ethyl]-1-(2-phenoxyethyl)piperidin-4-ol;dihydrochloride |
|---|---|
| PubChem CID | 21300860 |
| Molecular Formula | C25H38Cl2N2O3 |
| Molecular Weight | 485.50 g/mol |
| Exact Mass | 484.23 |
| IUPAC Name | 4-[2-(N-methyl-4-propan-2-yloxyanilino)ethyl]-1-(2-phenoxyethyl)piperidin-4-ol;dihydrochloride |
| SMILES | CC(C)Oc1ccc(N(C)CCC2(O)CCN(CCOc3ccccc3)CC2)cc1.Cl.Cl |
| InChI | InChI=1S/C25H36N2O3.2ClH/c1-21(2)30-24-11-9-22(10-12-24)26(3)16-13-25(28)14-17-27(18-15-25)19-20-29-23-7-5-4-6-8-23;;/h4-12,21,28H,13-20H2,1-3H3;2*1H |
| InChIKey | VXTNJQHKAIMSOR-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 45.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.50 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|