C26H38Cl2N2O2 — CID 21300713
1-benzyl-4-[2-[4-(2-cyclopropylethoxy)-N-methylanilino]ethyl]piperidin-4-ol;dihydrochloride (PubChem CID 21300713) has the molecular formula C26H38Cl2N2O2 and a molecular weight of 481.51 g/mol. Its IUPAC name is 1-benzyl-4-[2-[4-(2-cyclopropylethoxy)-N-methylanilino]ethyl]piperidin-4-ol;dihydrochloride.
| Compound Name | 1-benzyl-4-[2-[4-(2-cyclopropylethoxy)-N-methylanilino]ethyl]piperidin-4-ol;dihydrochloride |
|---|---|
| PubChem CID | 21300713 |
| Molecular Formula | C26H38Cl2N2O2 |
| Molecular Weight | 481.51 g/mol |
| Exact Mass | 480.23 |
| IUPAC Name | 1-benzyl-4-[2-[4-(2-cyclopropylethoxy)-N-methylanilino]ethyl]piperidin-4-ol;dihydrochloride |
| SMILES | CN(CCC1(O)CCN(Cc2ccccc2)CC1)c1ccc(OCCC2CC2)cc1.Cl.Cl |
| InChI | InChI=1S/C26H36N2O2.2ClH/c1-27(24-9-11-25(12-10-24)30-20-13-22-7-8-22)17-14-26(29)15-18-28(19-16-26)21-23-5-3-2-4-6-23;;/h2-6,9-12,22,29H,7-8,13-21H2,1H3;2*1H |
| InChIKey | DSDXOWFNYWYNMT-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.51 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|