C24H35Cl2N3O4 — CID 21300857
4-[2-(N-methyl-4-propan-2-yloxyanilino)ethyl]-1-[(2-nitrophenyl)methyl]piperidin-4-ol;dihydrochloride (PubChem CID 21300857) has the molecular formula C24H35Cl2N3O4 and a molecular weight of 500.47 g/mol. Its IUPAC name is 4-[2-(N-methyl-4-propan-2-yloxyanilino)ethyl]-1-[(2-nitrophenyl)methyl]piperidin-4-ol;dihydrochloride.
| Compound Name | 4-[2-(N-methyl-4-propan-2-yloxyanilino)ethyl]-1-[(2-nitrophenyl)methyl]piperidin-4-ol;dihydrochloride |
|---|---|
| PubChem CID | 21300857 |
| Molecular Formula | C24H35Cl2N3O4 |
| Molecular Weight | 500.47 g/mol |
| Exact Mass | 499.20 |
| IUPAC Name | 4-[2-(N-methyl-4-propan-2-yloxyanilino)ethyl]-1-[(2-nitrophenyl)methyl]piperidin-4-ol;dihydrochloride |
| SMILES | CC(C)Oc1ccc(N(C)CCC2(O)CCN(Cc3ccccc3[N+](=O)[O-])CC2)cc1.Cl.Cl |
| InChI | InChI=1S/C24H33N3O4.2ClH/c1-19(2)31-22-10-8-21(9-11-22)25(3)15-12-24(28)13-16-26(17-14-24)18-20-6-4-5-7-23(20)27(29)30;;/h4-11,19,28H,12-18H2,1-3H3;2*1H |
| InChIKey | HOTCVXQTIXRNMZ-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 79.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.47 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|