C25H35BrN2O2 — CID 18002847
1-[2-(4-bromophenyl)ethyl]-4-[2-(N-methyl-4-propan-2-yloxyanilino)ethyl]piperidin-4-ol (PubChem CID 18002847) has the molecular formula C25H35BrN2O2 and a molecular weight of 475.47 g/mol. Its IUPAC name is 1-[2-(4-bromophenyl)ethyl]-4-[2-(N-methyl-4-propan-2-yloxyanilino)ethyl]piperidin-4-ol.
| Compound Name | 1-[2-(4-bromophenyl)ethyl]-4-[2-(N-methyl-4-propan-2-yloxyanilino)ethyl]piperidin-4-ol |
|---|---|
| PubChem CID | 18002847 |
| Molecular Formula | C25H35BrN2O2 |
| Molecular Weight | 475.47 g/mol |
| Exact Mass | 474.19 |
| IUPAC Name | 1-[2-(4-bromophenyl)ethyl]-4-[2-(N-methyl-4-propan-2-yloxyanilino)ethyl]piperidin-4-ol |
| SMILES | CC(C)Oc1ccc(N(C)CCC2(O)CCN(CCc3ccc(Br)cc3)CC2)cc1 |
| InChI | InChI=1S/C25H35BrN2O2/c1-20(2)30-24-10-8-23(9-11-24)27(3)17-13-25(29)14-18-28(19-15-25)16-12-21-4-6-22(26)7-5-21/h4-11,20,29H,12-19H2,1-3H3 |
| InChIKey | FZWJNQVDQXGMSF-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.47 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|