C25H35Cl2N3O2 — CID 18002904
4-[2-[4-hydroxy-4-[2-(4-propan-2-yloxyanilino)ethyl]piperidin-1-yl]ethyl]benzonitrile;dihydrochloride (PubChem CID 18002904) has the molecular formula C25H35Cl2N3O2 and a molecular weight of 480.48 g/mol. Its IUPAC name is 4-[2-[4-hydroxy-4-[2-(4-propan-2-yloxyanilino)ethyl]piperidin-1-yl]ethyl]benzonitrile;dihydrochloride.
| Compound Name | 4-[2-[4-hydroxy-4-[2-(4-propan-2-yloxyanilino)ethyl]piperidin-1-yl]ethyl]benzonitrile;dihydrochloride |
|---|---|
| PubChem CID | 18002904 |
| Molecular Formula | C25H35Cl2N3O2 |
| Molecular Weight | 480.48 g/mol |
| Exact Mass | 479.21 |
| IUPAC Name | 4-[2-[4-hydroxy-4-[2-(4-propan-2-yloxyanilino)ethyl]piperidin-1-yl]ethyl]benzonitrile;dihydrochloride |
| SMILES | CC(C)Oc1ccc(NCCC2(O)CCN(CCc3ccc(C#N)cc3)CC2)cc1.Cl.Cl |
| InChI | InChI=1S/C25H33N3O2.2ClH/c1-20(2)30-24-9-7-23(8-10-24)27-15-12-25(29)13-17-28(18-14-25)16-11-21-3-5-22(19-26)6-4-21;;/h3-10,20,27,29H,11-18H2,1-2H3;2*1H |
| InChIKey | PULFUPPKBVYDPK-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.48 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|