C19H32N2O3 — CID 21300791
4-[2-(4-butoxy-N-methylanilino)-1-methoxyethyl]piperidin-4-ol (PubChem CID 21300791) has the molecular formula C19H32N2O3 and a molecular weight of 336.48 g/mol. Its IUPAC name is 4-[2-(4-butoxy-N-methylanilino)-1-methoxyethyl]piperidin-4-ol.
| Compound Name | 4-[2-(4-butoxy-N-methylanilino)-1-methoxyethyl]piperidin-4-ol |
|---|---|
| PubChem CID | 21300791 |
| Molecular Formula | C19H32N2O3 |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.24 |
| IUPAC Name | 4-[2-(4-butoxy-N-methylanilino)-1-methoxyethyl]piperidin-4-ol |
| SMILES | CCCCOc1ccc(N(C)CC(OC)C2(O)CCNCC2)cc1 |
| InChI | InChI=1S/C19H32N2O3/c1-4-5-14-24-17-8-6-16(7-9-17)21(2)15-18(23-3)19(22)10-12-20-13-11-19/h6-9,18,20,22H,4-5,10-15H2,1-3H3 |
| InChIKey | MAMRNXAFBZLLQW-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 53.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|