C26H36N2O4 — CID 21300923
2-(1-benzyl-4-hydroxypiperidin-4-yl)-N-(4-butoxyphenyl)-2-methoxy-N-methylacetamide (PubChem CID 21300923) has the molecular formula C26H36N2O4 and a molecular weight of 440.58 g/mol. Its IUPAC name is 2-(1-benzyl-4-hydroxypiperidin-4-yl)-N-(4-butoxyphenyl)-2-methoxy-N-methylacetamide.
| Compound Name | 2-(1-benzyl-4-hydroxypiperidin-4-yl)-N-(4-butoxyphenyl)-2-methoxy-N-methylacetamide |
|---|---|
| PubChem CID | 21300923 |
| Molecular Formula | C26H36N2O4 |
| Molecular Weight | 440.58 g/mol |
| Exact Mass | 440.27 |
| IUPAC Name | 2-(1-benzyl-4-hydroxypiperidin-4-yl)-N-(4-butoxyphenyl)-2-methoxy-N-methylacetamide |
| SMILES | CCCCOc1ccc(N(C)C(=O)C(OC)C2(O)CCN(Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C26H36N2O4/c1-4-5-19-32-23-13-11-22(12-14-23)27(2)25(29)24(31-3)26(30)15-17-28(18-16-26)20-21-9-7-6-8-10-21/h6-14,24,30H,4-5,15-20H2,1-3H3 |
| InChIKey | ZNPHOABGZWNZIG-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.58 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|