C17H22O4 — CID 21301429
(3-oxo-2-oxabicyclo[3.2.1]octan-4-yl)methyl 2-methylbicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 21301429) has the molecular formula C17H22O4 and a molecular weight of 290.36 g/mol. Its IUPAC name is (3-oxo-2-oxabicyclo[3.2.1]octan-4-yl)methyl 2-methylbicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | (3-oxo-2-oxabicyclo[3.2.1]octan-4-yl)methyl 2-methylbicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 21301429 |
| Molecular Formula | C17H22O4 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | (3-oxo-2-oxabicyclo[3.2.1]octan-4-yl)methyl 2-methylbicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | CC1(C(=O)OCC2C(=O)OC3CCC2C3)CC2C=CC1C2 |
| InChI | InChI=1S/C17H22O4/c1-17(8-10-2-4-12(17)6-10)16(19)20-9-14-11-3-5-13(7-11)21-15(14)18/h2,4,10-14H,3,5-9H2,1H3 |
| InChIKey | BNUGUNCJGZVCKU-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|