C20H30O4 — CID 565135
2-(4-methylcyclohex-3-en-1-yl)propyl 1,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-4-carboxylate (PubChem CID 565135) has the molecular formula C20H30O4 and a molecular weight of 334.46 g/mol. Its IUPAC name is 2-(4-methylcyclohex-3-en-1-yl)propyl 1,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-4-carboxylate.
| Compound Name | 2-(4-methylcyclohex-3-en-1-yl)propyl 1,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-4-carboxylate |
|---|---|
| PubChem CID | 565135 |
| Molecular Formula | C20H30O4 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | 2-(4-methylcyclohex-3-en-1-yl)propyl 1,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-4-carboxylate |
| SMILES | CC1=CCC(C(C)COC(=O)C23CCC(C)(OC2=O)C3(C)C)CC1 |
| InChI | InChI=1S/C20H30O4/c1-13-6-8-15(9-7-13)14(2)12-23-16(21)20-11-10-19(5,18(20,3)4)24-17(20)22/h6,14-15H,7-12H2,1-5H3 |
| InChIKey | GMWJHPIPNAGJEJ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|