C20H26O5 — CID 135009911
diethyl (1R,11R)-15-oxatetracyclo[7.5.1.01,11.03,8]pentadeca-2,7-diene-13,13-dicarboxylate (PubChem CID 135009911) has the molecular formula C20H26O5 and a molecular weight of 346.42 g/mol. Its IUPAC name is diethyl (1R,11R)-15-oxatetracyclo[7.5.1.01,11.03,8]pentadeca-2,7-diene-13,13-dicarboxylate.
| Compound Name | diethyl (1R,11R)-15-oxatetracyclo[7.5.1.01,11.03,8]pentadeca-2,7-diene-13,13-dicarboxylate |
|---|---|
| PubChem CID | 135009911 |
| Molecular Formula | C20H26O5 |
| Molecular Weight | 346.42 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | diethyl (1R,11R)-15-oxatetracyclo[7.5.1.01,11.03,8]pentadeca-2,7-diene-13,13-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)C[C@@H]2CC3O[C@]2(C=C2CCCC=C23)C1 |
| InChI | InChI=1S/C20H26O5/c1-3-23-17(21)19(18(22)24-4-2)11-14-9-16-15-8-6-5-7-13(15)10-20(14,12-19)25-16/h8,10,14,16H,3-7,9,11-12H2,1-2H3/t14-,16?,20+/m0/s1 |
| InChIKey | FUPKHRYKOAIVSF-MEYYYXTJSA-N |
| XLogP | 3.09 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.42 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|