C20H28O5 — CID 102286662
diethyl (1R,5S,8S)-7-tert-butyl-11-oxatricyclo[6.2.1.01,5]undeca-6,9-diene-3,3-dicarboxylate (PubChem CID 102286662) has the molecular formula C20H28O5 and a molecular weight of 348.44 g/mol. Its IUPAC name is diethyl (1R,5S,8S)-7-tert-butyl-11-oxatricyclo[6.2.1.01,5]undeca-6,9-diene-3,3-dicarboxylate.
| Compound Name | diethyl (1R,5S,8S)-7-tert-butyl-11-oxatricyclo[6.2.1.01,5]undeca-6,9-diene-3,3-dicarboxylate |
|---|---|
| PubChem CID | 102286662 |
| Molecular Formula | C20H28O5 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.19 |
| IUPAC Name | diethyl (1R,5S,8S)-7-tert-butyl-11-oxatricyclo[6.2.1.01,5]undeca-6,9-diene-3,3-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)C[C@H]2C=C(C(C)(C)C)[C@@H]3C=C[C@@]2(C1)O3 |
| InChI | InChI=1S/C20H28O5/c1-6-23-16(21)19(17(22)24-7-2)11-13-10-14(18(3,4)5)15-8-9-20(13,12-19)25-15/h8-10,13,15H,6-7,11-12H2,1-5H3/t13-,15+,20+/m1/s1 |
| InChIKey | XAVFHGFTMWETRE-AFBRZQFHSA-N |
| XLogP | 3.19 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|