C17H22O5 — CID 135061332
diethyl (1R,7S,8S)-7-methyl-11-oxatricyclo[6.2.1.01,5]undeca-5,9-diene-3,3-dicarboxylate (PubChem CID 135061332) has the molecular formula C17H22O5 and a molecular weight of 306.36 g/mol. Its IUPAC name is diethyl (1R,7S,8S)-7-methyl-11-oxatricyclo[6.2.1.01,5]undeca-5,9-diene-3,3-dicarboxylate.
| Compound Name | diethyl (1R,7S,8S)-7-methyl-11-oxatricyclo[6.2.1.01,5]undeca-5,9-diene-3,3-dicarboxylate |
|---|---|
| PubChem CID | 135061332 |
| Molecular Formula | C17H22O5 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | diethyl (1R,7S,8S)-7-methyl-11-oxatricyclo[6.2.1.01,5]undeca-5,9-diene-3,3-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)CC2=C[C@H](C)[C@@H]3C=C[C@@]2(C1)O3 |
| InChI | InChI=1S/C17H22O5/c1-4-20-14(18)16(15(19)21-5-2)9-12-8-11(3)13-6-7-17(12,10-16)22-13/h6-8,11,13H,4-5,9-10H2,1-3H3/t11-,13-,17-/m0/s1 |
| InChIKey | OGQBEFIPOCIUPK-BNLOLNQZSA-N |
| XLogP | 2.16 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|