C16H24O5 — CID 10968466
diethyl (3aR,4R,5R,7aS)-4-hydroxy-5-methyl-1,3,3a,4,5,7a-hexahydroindene-2,2-dicarboxylate (PubChem CID 10968466) has the molecular formula C16H24O5 and a molecular weight of 296.36 g/mol. Its IUPAC name is diethyl (3aR,4R,5R,7aS)-4-hydroxy-5-methyl-1,3,3a,4,5,7a-hexahydroindene-2,2-dicarboxylate.
| Compound Name | diethyl (3aR,4R,5R,7aS)-4-hydroxy-5-methyl-1,3,3a,4,5,7a-hexahydroindene-2,2-dicarboxylate |
|---|---|
| PubChem CID | 10968466 |
| Molecular Formula | C16H24O5 |
| Molecular Weight | 296.36 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | diethyl (3aR,4R,5R,7aS)-4-hydroxy-5-methyl-1,3,3a,4,5,7a-hexahydroindene-2,2-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)C[C@H]2[C@H](O)[C@H](C)C=C[C@@H]2C1 |
| InChI | InChI=1S/C16H24O5/c1-4-20-14(18)16(15(19)21-5-2)8-11-7-6-10(3)13(17)12(11)9-16/h6-7,10-13,17H,4-5,8-9H2,1-3H3/t10-,11-,12-,13-/m1/s1 |
| InChIKey | SHXUAAMULFHRMI-FDYHWXHSSA-N |
| XLogP | 1.69 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.36 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|