C15H21Cl5O4 — CID 12063565
diethyl 3-methyl-4-(2,2,3,3,3-pentachloropropyl)cyclopentane-1,1-dicarboxylate (PubChem CID 12063565) has the molecular formula C15H21Cl5O4 and a molecular weight of 442.59 g/mol. Its IUPAC name is diethyl 3-methyl-4-(2,2,3,3,3-pentachloropropyl)cyclopentane-1,1-dicarboxylate.
| Compound Name | diethyl 3-methyl-4-(2,2,3,3,3-pentachloropropyl)cyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 12063565 |
| Molecular Formula | C15H21Cl5O4 |
| Molecular Weight | 442.59 g/mol |
| Exact Mass | 439.99 |
| IUPAC Name | diethyl 3-methyl-4-(2,2,3,3,3-pentachloropropyl)cyclopentane-1,1-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)CC(C)C(CC(Cl)(Cl)C(Cl)(Cl)Cl)C1 |
| InChI | InChI=1S/C15H21Cl5O4/c1-4-23-11(21)13(12(22)24-5-2)6-9(3)10(7-13)8-14(16,17)15(18,19)20/h9-10H,4-8H2,1-3H3 |
| InChIKey | SQIPBVFSTVIVSQ-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.59 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|