C19H26O7 — CID 25187377
diethyl (1R,2R,5R,7S)-2-(2-ethoxy-2-oxoethyl)-10-oxatricyclo[5.2.1.01,5]dec-8-ene-3,3-dicarboxylate (PubChem CID 25187377) has the molecular formula C19H26O7 and a molecular weight of 366.41 g/mol. Its IUPAC name is diethyl (1R,2R,5R,7S)-2-(2-ethoxy-2-oxoethyl)-10-oxatricyclo[5.2.1.01,5]dec-8-ene-3,3-dicarboxylate.
| Compound Name | diethyl (1R,2R,5R,7S)-2-(2-ethoxy-2-oxoethyl)-10-oxatricyclo[5.2.1.01,5]dec-8-ene-3,3-dicarboxylate |
|---|---|
| PubChem CID | 25187377 |
| Molecular Formula | C19H26O7 |
| Molecular Weight | 366.41 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | diethyl (1R,2R,5R,7S)-2-(2-ethoxy-2-oxoethyl)-10-oxatricyclo[5.2.1.01,5]dec-8-ene-3,3-dicarboxylate |
| SMILES | CCOC(=O)C[C@@H]1C(C(=O)OCC)(C(=O)OCC)C[C@@H]2C[C@H]3C=C[C@]21O3 |
| InChI | InChI=1S/C19H26O7/c1-4-23-15(20)10-14-18(16(21)24-5-2,17(22)25-6-3)11-12-9-13-7-8-19(12,14)26-13/h7-8,12-14H,4-6,9-11H2,1-3H3/t12-,13+,14+,19-/m0/s1 |
| InChIKey | RLHGTPXULUOAKB-HLBODDRNSA-N |
| XLogP | 1.79 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.41 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|