C18H22O6 — CID 71730004
bis(prop-2-enyl) (1S,2S,5R)-5-methyl-7-oxo-2-[(E)-prop-1-enyl]-6-oxabicyclo[3.2.0]heptane-3,3-dicarboxylate (PubChem CID 71730004) has the molecular formula C18H22O6 and a molecular weight of 334.37 g/mol. Its IUPAC name is bis(prop-2-enyl) (1S,2S,5R)-5-methyl-7-oxo-2-[(E)-prop-1-enyl]-6-oxabicyclo[3.2.0]heptane-3,3-dicarboxylate.
| Compound Name | bis(prop-2-enyl) (1S,2S,5R)-5-methyl-7-oxo-2-[(E)-prop-1-enyl]-6-oxabicyclo[3.2.0]heptane-3,3-dicarboxylate |
|---|---|
| PubChem CID | 71730004 |
| Molecular Formula | C18H22O6 |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | bis(prop-2-enyl) (1S,2S,5R)-5-methyl-7-oxo-2-[(E)-prop-1-enyl]-6-oxabicyclo[3.2.0]heptane-3,3-dicarboxylate |
| SMILES | C=CCOC(=O)C1(C(=O)OCC=C)C[C@@]2(C)OC(=O)[C@H]2[C@@H]1/C=C/C |
| InChI | InChI=1S/C18H22O6/c1-5-8-12-13-14(19)24-17(13,4)11-18(12,15(20)22-9-6-2)16(21)23-10-7-3/h5-8,12-13H,2-3,9-11H2,1,4H3/b8-5+/t12-,13+,17+/m0/s1 |
| InChIKey | FCFIHLFIKYRPIF-QLUWGJEGSA-N |
| XLogP | 1.96 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'four_member_lactones', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|