About 6-[2-(3,3-dimethyl-6-oxohexoxy)ethoxy]-4,4-dimethylhexanal
6-[2-(3,3-dimethyl-6-oxohexoxy)ethoxy]-4,4-dimethylhexanal (PubChem CID 21303524) has the molecular formula C18H34O4
and a molecular weight of 314.47 g/mol. Its IUPAC name is 6-[2-(3,3-dimethyl-6-oxohexoxy)ethoxy]-4,4-dimethylhexanal.
Molecular Properties
| Compound Name | 6-[2-(3,3-dimethyl-6-oxohexoxy)ethoxy]-4,4-dimethylhexanal |
| PubChem CID | 21303524 |
| Molecular Formula | C18H34O4 |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.25 |
| IUPAC Name | 6-[2-(3,3-dimethyl-6-oxohexoxy)ethoxy]-4,4-dimethylhexanal |
| SMILES | CC(C)(CCC=O)CCOCCOCCC(C)(C)CCC=O |
| InChI | InChI=1S/C18H34O4/c1-17(2,7-5-11-19)9-13-21-15-16-22-14-10-18(3,4)8-6-12-20/h11-12H,5-10,13-16H2,1-4H3 |
| InChIKey | RQXDEMKQQHVUSJ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-[2-(3,3-dimethyl-6-oxohexoxy)ethoxy]-4,4-dimethylhexanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[2-(3,3-dimethyl-6-oxohexoxy)ethoxy]-4,4-dimethylhexanal?
The IUPAC name of 6-[2-(3,3-dimethyl-6-oxohexoxy)ethoxy]-4,4-dimethylhexanal (CID 21303524) is 6-[2-(3,3-dimethyl-6-oxohexoxy)ethoxy]-4,4-dimethylhexanal.
What is the SMILES notation for 6-[2-(3,3-dimethyl-6-oxohexoxy)ethoxy]-4,4-dimethylhexanal?
The canonical SMILES for 6-[2-(3,3-dimethyl-6-oxohexoxy)ethoxy]-4,4-dimethylhexanal is CC(C)(CCC=O)CCOCCOCCC(C)(C)CCC=O.
What is the InChIKey of 6-[2-(3,3-dimethyl-6-oxohexoxy)ethoxy]-4,4-dimethylhexanal?
The InChIKey is RQXDEMKQQHVUSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H34O4/c1-17(2,7-5-11-19)9-13-21-15-16-22-14-10-18(3,4)8-6-12-20/h11-12H,5-10,13-16H2,1-4H3.
What are the key properties of 6-[2-(3,3-dimethyl-6-oxohexoxy)ethoxy]-4,4-dimethylhexanal?
6-[2-(3,3-dimethyl-6-oxohexoxy)ethoxy]-4,4-dimethylhexanal has a molecular weight of 314.47 g/mol, XLogP of 3.81, 15 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[2-(3,3-dimethyl-6-oxohexoxy)ethoxy]-4,4-dimethylhexanal is sourced from PubChem (CID 21303524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).