C18H34O4 — CID 21303524
6-[2-(3,3-dimethyl-6-oxohexoxy)ethoxy]-4,4-dimethylhexanal (PubChem CID 21303524) has the molecular formula C18H34O4 and a molecular weight of 314.47 g/mol. Its IUPAC name is 6-[2-(3,3-dimethyl-6-oxohexoxy)ethoxy]-4,4-dimethylhexanal.
| Compound Name | 6-[2-(3,3-dimethyl-6-oxohexoxy)ethoxy]-4,4-dimethylhexanal |
|---|---|
| PubChem CID | 21303524 |
| Molecular Formula | C18H34O4 |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.25 |
| IUPAC Name | 6-[2-(3,3-dimethyl-6-oxohexoxy)ethoxy]-4,4-dimethylhexanal |
| SMILES | CC(C)(CCC=O)CCOCCOCCC(C)(C)CCC=O |
| InChI | InChI=1S/C18H34O4/c1-17(2,7-5-11-19)9-13-21-15-16-22-14-10-18(3,4)8-6-12-20/h11-12H,5-10,13-16H2,1-4H3 |
| InChIKey | RQXDEMKQQHVUSJ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|