C20H16Cl3N3O2 — CID 21303650
5-oxo-N-[(4-prop-1-en-2-ylphenyl)methyl]-1-(2,4,6-trichlorophenyl)-4H-pyrazole-3-carboxamide (PubChem CID 21303650) has the molecular formula C20H16Cl3N3O2 and a molecular weight of 436.73 g/mol. Its IUPAC name is 5-oxo-N-[(4-prop-1-en-2-ylphenyl)methyl]-1-(2,4,6-trichlorophenyl)-4H-pyrazole-3-carboxamide.
| Compound Name | 5-oxo-N-[(4-prop-1-en-2-ylphenyl)methyl]-1-(2,4,6-trichlorophenyl)-4H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 21303650 |
| Molecular Formula | C20H16Cl3N3O2 |
| Molecular Weight | 436.73 g/mol |
| Exact Mass | 435.03 |
| IUPAC Name | 5-oxo-N-[(4-prop-1-en-2-ylphenyl)methyl]-1-(2,4,6-trichlorophenyl)-4H-pyrazole-3-carboxamide |
| SMILES | C=C(C)c1ccc(CNC(=O)C2=NN(c3c(Cl)cc(Cl)cc3Cl)C(=O)C2)cc1 |
| InChI | InChI=1S/C20H16Cl3N3O2/c1-11(2)13-5-3-12(4-6-13)10-24-20(28)17-9-18(27)26(25-17)19-15(22)7-14(21)8-16(19)23/h3-8H,1,9-10H2,2H3,(H,24,28) |
| InChIKey | JVHCDENUIOLALR-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.73 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het_5_A(7)', 'substructure': 'N/A'} |
|---|