C9H16 — CID 21304360
2,6-dimethylspiro[3.3]heptane (PubChem CID 21304360) has the molecular formula C9H16 and a molecular weight of 124.23 g/mol. Its IUPAC name is 2,6-dimethylspiro[3.3]heptane.
| Compound Name | 2,6-dimethylspiro[3.3]heptane |
|---|---|
| PubChem CID | 21304360 |
| Molecular Formula | C9H16 |
| Molecular Weight | 124.23 g/mol |
| Exact Mass | 124.13 |
| IUPAC Name | 2,6-dimethylspiro[3.3]heptane |
| SMILES | CC1CC2(C1)CC(C)C2 |
| InChI | InChI=1S/C9H16/c1-7-3-9(4-7)5-8(2)6-9/h7-8H,3-6H2,1-2H3 |
| InChIKey | XSMNCVPNJTZYQT-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 124.23 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |