C30H34N4O5 — CID 21309551
benzyl 4-[4-[(1R,4S)-4-(oxan-2-yloxy)cyclopent-2-en-1-yl]oxyquinazolin-2-yl]piperazine-1-carboxylate (PubChem CID 21309551) has the molecular formula C30H34N4O5 and a molecular weight of 530.63 g/mol. Its IUPAC name is benzyl 4-[4-[(1R,4S)-4-(oxan-2-yloxy)cyclopent-2-en-1-yl]oxyquinazolin-2-yl]piperazine-1-carboxylate.
| Compound Name | benzyl 4-[4-[(1R,4S)-4-(oxan-2-yloxy)cyclopent-2-en-1-yl]oxyquinazolin-2-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 21309551 |
| Molecular Formula | C30H34N4O5 |
| Molecular Weight | 530.63 g/mol |
| Exact Mass | 530.25 |
| IUPAC Name | benzyl 4-[4-[(1R,4S)-4-(oxan-2-yloxy)cyclopent-2-en-1-yl]oxyquinazolin-2-yl]piperazine-1-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1CCN(c2nc(O[C@H]3C=C[C@@H](OC4CCCCO4)C3)c3ccccc3n2)CC1 |
| InChI | InChI=1S/C30H34N4O5/c35-30(37-21-22-8-2-1-3-9-22)34-17-15-33(16-18-34)29-31-26-11-5-4-10-25(26)28(32-29)39-24-14-13-23(20-24)38-27-12-6-7-19-36-27/h1-5,8-11,13-14,23-24,27H,6-7,12,15-21H2/t23-,24+,27?/m1/s1 |
| InChIKey | VLIBPLUJNLCZIR-AVPLEESXSA-N |
| XLogP | 4.71 |
| TPSA | 86.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.63 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|