C33H47N3O7 — CID 21311185
2-amino-4-methylpentanoic acid;(2R)-2-[[(1S)-1-carboxy-3-(4-propylphenyl)propyl]amino]-6-(3-oxo-1H-isoindol-2-yl)hexanoic acid (PubChem CID 21311185) has the molecular formula C33H47N3O7 and a molecular weight of 597.75 g/mol. Its IUPAC name is 2-amino-4-methylpentanoic acid;(2R)-2-[[(1S)-1-carboxy-3-(4-propylphenyl)propyl]amino]-6-(3-oxo-1H-isoindol-2-yl)hexanoic acid.
| Compound Name | 2-amino-4-methylpentanoic acid;(2R)-2-[[(1S)-1-carboxy-3-(4-propylphenyl)propyl]amino]-6-(3-oxo-1H-isoindol-2-yl)hexanoic acid |
|---|---|
| PubChem CID | 21311185 |
| Molecular Formula | C33H47N3O7 |
| Molecular Weight | 597.75 g/mol |
| Exact Mass | 597.34 |
| IUPAC Name | 2-amino-4-methylpentanoic acid;(2R)-2-[[(1S)-1-carboxy-3-(4-propylphenyl)propyl]amino]-6-(3-oxo-1H-isoindol-2-yl)hexanoic acid |
| SMILES | CC(C)CC(N)C(=O)O.CCCc1ccc(CC[C@H](N[C@H](CCCCN2Cc3ccccc3C2=O)C(=O)O)C(=O)O)cc1 |
| InChI | InChI=1S/C27H34N2O5.C6H13NO2/c1-2-7-19-11-13-20(14-12-19)15-16-24(27(33)34)28-23(26(31)32)10-5-6-17-29-18-21-8-3-4-9-22(21)25(29)30;1-4(2)3-5(7)6(8)9/h3-4,8-9,11-14,23-24,28H,2,5-7,10,15-18H2,1H3,(H,31,32)(H,33,34);4-5H,3,7H2,1-2H3,(H,8,9)/t23-,24+;/m1./s1 |
| InChIKey | WRKVTZFMNYDDEM-ITNPDYSASA-N |
| XLogP | 4.34 |
| TPSA | 170.26 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.75 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|