C14H23N3O5S2 — CID 21312723
2-[(4-aminophenyl)sulfonylamino]ethyl N-cyclohexylsulfamate (PubChem CID 21312723) has the molecular formula C14H23N3O5S2 and a molecular weight of 377.49 g/mol. Its IUPAC name is 2-[(4-aminophenyl)sulfonylamino]ethyl N-cyclohexylsulfamate.
| Compound Name | 2-[(4-aminophenyl)sulfonylamino]ethyl N-cyclohexylsulfamate |
|---|---|
| PubChem CID | 21312723 |
| Molecular Formula | C14H23N3O5S2 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.11 |
| IUPAC Name | 2-[(4-aminophenyl)sulfonylamino]ethyl N-cyclohexylsulfamate |
| SMILES | Nc1ccc(S(=O)(=O)NCCOS(=O)(=O)NC2CCCCC2)cc1 |
| InChI | InChI=1S/C14H23N3O5S2/c15-12-6-8-14(9-7-12)23(18,19)16-10-11-22-24(20,21)17-13-4-2-1-3-5-13/h6-9,13,16-17H,1-5,10-11,15H2 |
| InChIKey | BUVLBCYDIVVCLW-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 127.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|