C16H16Cl2N4O2 — CID 21313103
N-[(5-tert-butylpyrazin-2-yl)carbamoyl]-2,6-dichlorobenzamide (PubChem CID 21313103) has the molecular formula C16H16Cl2N4O2 and a molecular weight of 367.24 g/mol. Its IUPAC name is N-[(5-tert-butylpyrazin-2-yl)carbamoyl]-2,6-dichlorobenzamide.
| Compound Name | N-[(5-tert-butylpyrazin-2-yl)carbamoyl]-2,6-dichlorobenzamide |
|---|---|
| PubChem CID | 21313103 |
| Molecular Formula | C16H16Cl2N4O2 |
| Molecular Weight | 367.24 g/mol |
| Exact Mass | 366.07 |
| IUPAC Name | N-[(5-tert-butylpyrazin-2-yl)carbamoyl]-2,6-dichlorobenzamide |
| SMILES | CC(C)(C)c1cnc(NC(=O)NC(=O)c2c(Cl)cccc2Cl)cn1 |
| InChI | InChI=1S/C16H16Cl2N4O2/c1-16(2,3)11-7-20-12(8-19-11)21-15(24)22-14(23)13-9(17)5-4-6-10(13)18/h4-8H,1-3H3,(H2,20,21,22,23,24) |
| InChIKey | XKHSYJSXVFDRIK-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.24 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |