C12H8ClN5O4 — CID 20567047
2-chloro-N-[(5-nitropyrazin-2-yl)carbamoyl]benzamide (PubChem CID 20567047) has the molecular formula C12H8ClN5O4 and a molecular weight of 321.68 g/mol. Its IUPAC name is 2-chloro-N-[(5-nitropyrazin-2-yl)carbamoyl]benzamide.
| Compound Name | 2-chloro-N-[(5-nitropyrazin-2-yl)carbamoyl]benzamide |
|---|---|
| PubChem CID | 20567047 |
| Molecular Formula | C12H8ClN5O4 |
| Molecular Weight | 321.68 g/mol |
| Exact Mass | 321.03 |
| IUPAC Name | 2-chloro-N-[(5-nitropyrazin-2-yl)carbamoyl]benzamide |
| SMILES | O=C(NC(=O)c1ccccc1Cl)Nc1cnc([N+](=O)[O-])cn1 |
| InChI | InChI=1S/C12H8ClN5O4/c13-8-4-2-1-3-7(8)11(19)17-12(20)16-9-5-15-10(6-14-9)18(21)22/h1-6H,(H2,14,16,17,19,20) |
| InChIKey | JQNIDYUACYFXMJ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 127.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.68 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|