About 2,2-dibenzyl-1,3-thiazolidine-4-carbonitrile
2,2-dibenzyl-1,3-thiazolidine-4-carbonitrile (PubChem CID 21316403) has the molecular formula C18H18N2S
and a molecular weight of 294.42 g/mol. Its IUPAC name is 2,2-dibenzyl-1,3-thiazolidine-4-carbonitrile.
Molecular Properties
| Compound Name | 2,2-dibenzyl-1,3-thiazolidine-4-carbonitrile |
| PubChem CID | 21316403 |
| Molecular Formula | C18H18N2S |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | 2,2-dibenzyl-1,3-thiazolidine-4-carbonitrile |
| SMILES | N#CC1CSC(Cc2ccccc2)(Cc2ccccc2)N1 |
| InChI | InChI=1S/C18H18N2S/c19-13-17-14-21-18(20-17,11-15-7-3-1-4-8-15)12-16-9-5-2-6-10-16/h1-10,17,20H,11-12,14H2 |
| InChIKey | BCZTXVQNYPJKIX-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,2-dibenzyl-1,3-thiazolidine-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dibenzyl-1,3-thiazolidine-4-carbonitrile?
The IUPAC name of 2,2-dibenzyl-1,3-thiazolidine-4-carbonitrile (CID 21316403) is 2,2-dibenzyl-1,3-thiazolidine-4-carbonitrile.
What is the SMILES notation for 2,2-dibenzyl-1,3-thiazolidine-4-carbonitrile?
The canonical SMILES for 2,2-dibenzyl-1,3-thiazolidine-4-carbonitrile is N#CC1CSC(Cc2ccccc2)(Cc2ccccc2)N1.
What is the InChIKey of 2,2-dibenzyl-1,3-thiazolidine-4-carbonitrile?
The InChIKey is BCZTXVQNYPJKIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18N2S/c19-13-17-14-21-18(20-17,11-15-7-3-1-4-8-15)12-16-9-5-2-6-10-16/h1-10,17,20H,11-12,14H2.
What are the key properties of 2,2-dibenzyl-1,3-thiazolidine-4-carbonitrile?
2,2-dibenzyl-1,3-thiazolidine-4-carbonitrile has a molecular weight of 294.42 g/mol, XLogP of 3.40, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dibenzyl-1,3-thiazolidine-4-carbonitrile is sourced from PubChem (CID 21316403), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).