C15H33N3 — CID 21325298
1,3,5-tributyltriazinane (PubChem CID 21325298) has the molecular formula C15H33N3 and a molecular weight of 255.45 g/mol. Its IUPAC name is 1,3,5-tributyltriazinane.
| Compound Name | 1,3,5-tributyltriazinane |
|---|---|
| PubChem CID | 21325298 |
| Molecular Formula | C15H33N3 |
| Molecular Weight | 255.45 g/mol |
| Exact Mass | 255.27 |
| IUPAC Name | 1,3,5-tributyltriazinane |
| SMILES | CCCCC1CN(CCCC)NN(CCCC)C1 |
| InChI | InChI=1S/C15H33N3/c1-4-7-10-15-13-17(11-8-5-2)16-18(14-15)12-9-6-3/h15-16H,4-14H2,1-3H3 |
| InChIKey | LIXHFPPEVMOLDJ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.45 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |