About 4,4-dimethoxy-2,5-dimethylhexan-3-one
4,4-dimethoxy-2,5-dimethylhexan-3-one (PubChem CID 21326054) has the molecular formula C10H20O3
and a molecular weight of 188.27 g/mol. Its IUPAC name is 4,4-dimethoxy-2,5-dimethylhexan-3-one.
Molecular Properties
| Compound Name | 4,4-dimethoxy-2,5-dimethylhexan-3-one |
| PubChem CID | 21326054 |
| Molecular Formula | C10H20O3 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.14 |
| IUPAC Name | 4,4-dimethoxy-2,5-dimethylhexan-3-one |
| SMILES | COC(OC)(C(=O)C(C)C)C(C)C |
| InChI | InChI=1S/C10H20O3/c1-7(2)9(11)10(12-5,13-6)8(3)4/h7-8H,1-6H3 |
| InChIKey | KWFRNVTUTFPAFY-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 4,4-dimethoxy-2,5-dimethylhexan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-dimethoxy-2,5-dimethylhexan-3-one?
The IUPAC name of 4,4-dimethoxy-2,5-dimethylhexan-3-one (CID 21326054) is 4,4-dimethoxy-2,5-dimethylhexan-3-one.
What is the SMILES notation for 4,4-dimethoxy-2,5-dimethylhexan-3-one?
The canonical SMILES for 4,4-dimethoxy-2,5-dimethylhexan-3-one is COC(OC)(C(=O)C(C)C)C(C)C.
What is the InChIKey of 4,4-dimethoxy-2,5-dimethylhexan-3-one?
The InChIKey is KWFRNVTUTFPAFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O3/c1-7(2)9(11)10(12-5,13-6)8(3)4/h7-8H,1-6H3.
What are the key properties of 4,4-dimethoxy-2,5-dimethylhexan-3-one?
4,4-dimethoxy-2,5-dimethylhexan-3-one has a molecular weight of 188.27 g/mol, XLogP of 1.86, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-dimethoxy-2,5-dimethylhexan-3-one is sourced from PubChem (CID 21326054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).