C17H30N2 — CID 21330385
2,2,6,6-tetramethyl-4-piperidin-1-yl-3-prop-2-enyl-1,3-dihydropyridine (PubChem CID 21330385) has the molecular formula C17H30N2 and a molecular weight of 262.44 g/mol. Its IUPAC name is 2,2,6,6-tetramethyl-4-piperidin-1-yl-3-prop-2-enyl-1,3-dihydropyridine.
| Compound Name | 2,2,6,6-tetramethyl-4-piperidin-1-yl-3-prop-2-enyl-1,3-dihydropyridine |
|---|---|
| PubChem CID | 21330385 |
| Molecular Formula | C17H30N2 |
| Molecular Weight | 262.44 g/mol |
| Exact Mass | 262.24 |
| IUPAC Name | 2,2,6,6-tetramethyl-4-piperidin-1-yl-3-prop-2-enyl-1,3-dihydropyridine |
| SMILES | C=CCC1C(N2CCCCC2)=CC(C)(C)NC1(C)C |
| InChI | InChI=1S/C17H30N2/c1-6-10-14-15(19-11-8-7-9-12-19)13-16(2,3)18-17(14,4)5/h6,13-14,18H,1,7-12H2,2-5H3 |
| InChIKey | VZVMNQHSYHYKFH-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.44 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|