3,8,12,13-tetrahydroxy-10,14-dimethyloctadecanoic acid

C20H40O6 — CID 21335513

IUPAC3,8,12,13-tetrahydroxy-10,14-dimethyloctadecanoic acid
SMILESCCCCC(C)C(O)C(O)CC(C)CC(O)CCCCC(O)CC(=O)O
InChIInChI=1S/C20H40O6/c1-4-5-8-15(3)20(26)18(23)12-14(2)11-16(21)9-6-7-10-17(22)13-19(24)25/h14-18,20-23,26H,4-13H2,1-3H3,(H,24,25)
InChIKeyZNCACPWAECBTQA-UHFFFAOYSA-N
MW376.53 g/mol
LogP2.71
Rot. Bonds16

About 3,8,12,13-tetrahydroxy-10,14-dimethyloctadecanoic acid

3,8,12,13-tetrahydroxy-10,14-dimethyloctadecanoic acid (PubChem CID 21335513) has the molecular formula C20H40O6 and a molecular weight of 376.53 g/mol. Its IUPAC name is 3,8,12,13-tetrahydroxy-10,14-dimethyloctadecanoic acid.

Molecular Properties

Compound Name3,8,12,13-tetrahydroxy-10,14-dimethyloctadecanoic acid
PubChem CID21335513
Molecular FormulaC20H40O6
Molecular Weight376.53 g/mol
Exact Mass376.28
IUPAC Name3,8,12,13-tetrahydroxy-10,14-dimethyloctadecanoic acid
SMILESCCCCC(C)C(O)C(O)CC(C)CC(O)CCCCC(O)CC(=O)O
InChIInChI=1S/C20H40O6/c1-4-5-8-15(3)20(26)18(23)12-14(2)11-16(21)9-6-7-10-17(22)13-19(24)25/h14-18,20-23,26H,4-13H2,1-3H3,(H,24,25)
InChIKeyZNCACPWAECBTQA-UHFFFAOYSA-N
XLogP2.71
TPSA118.22 Ų
H-Bond Donors5
H-Bond Acceptors5
Rotatable Bonds16
Heavy Atoms26
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500376.53
LogP ≤ 52.71
H-Bond Donors ≤ 55
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 3,8,12,13-tetrahydroxy-10,14-dimethyloctadecanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3,8,12,13-tetrahydroxy-10,14-dimethyloctadecanoic acid?
The IUPAC name of 3,8,12,13-tetrahydroxy-10,14-dimethyloctadecanoic acid (CID 21335513) is 3,8,12,13-tetrahydroxy-10,14-dimethyloctadecanoic acid.
What is the SMILES notation for 3,8,12,13-tetrahydroxy-10,14-dimethyloctadecanoic acid?
The canonical SMILES for 3,8,12,13-tetrahydroxy-10,14-dimethyloctadecanoic acid is CCCCC(C)C(O)C(O)CC(C)CC(O)CCCCC(O)CC(=O)O.
What is the InChIKey of 3,8,12,13-tetrahydroxy-10,14-dimethyloctadecanoic acid?
The InChIKey is ZNCACPWAECBTQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H40O6/c1-4-5-8-15(3)20(26)18(23)12-14(2)11-16(21)9-6-7-10-17(22)13-19(24)25/h14-18,20-23,26H,4-13H2,1-3H3,(H,24,25).
What are the key properties of 3,8,12,13-tetrahydroxy-10,14-dimethyloctadecanoic acid?
3,8,12,13-tetrahydroxy-10,14-dimethyloctadecanoic acid has a molecular weight of 376.53 g/mol, XLogP of 2.71, 16 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3,8,12,13-tetrahydroxy-10,14-dimethyloctadecanoic acid is sourced from PubChem (CID 21335513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).