C20H40O6 — CID 21335513
3,8,12,13-tetrahydroxy-10,14-dimethyloctadecanoic acid (PubChem CID 21335513) has the molecular formula C20H40O6 and a molecular weight of 376.53 g/mol. Its IUPAC name is 3,8,12,13-tetrahydroxy-10,14-dimethyloctadecanoic acid.
| Compound Name | 3,8,12,13-tetrahydroxy-10,14-dimethyloctadecanoic acid |
|---|---|
| PubChem CID | 21335513 |
| Molecular Formula | C20H40O6 |
| Molecular Weight | 376.53 g/mol |
| Exact Mass | 376.28 |
| IUPAC Name | 3,8,12,13-tetrahydroxy-10,14-dimethyloctadecanoic acid |
| SMILES | CCCCC(C)C(O)C(O)CC(C)CC(O)CCCCC(O)CC(=O)O |
| InChI | InChI=1S/C20H40O6/c1-4-5-8-15(3)20(26)18(23)12-14(2)11-16(21)9-6-7-10-17(22)13-19(24)25/h14-18,20-23,26H,4-13H2,1-3H3,(H,24,25) |
| InChIKey | ZNCACPWAECBTQA-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.53 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|