C22H47NO4 — CID 165365457
(2S,3S,10R,12S,14S,15R,16R)-2-amino-12,16-dimethylicosane-3,10,14,15-tetrol (PubChem CID 165365457) has the molecular formula C22H47NO4 and a molecular weight of 389.62 g/mol. Its IUPAC name is (2S,3S,10R,12S,14S,15R,16R)-2-amino-12,16-dimethylicosane-3,10,14,15-tetrol.
| Compound Name | (2S,3S,10R,12S,14S,15R,16R)-2-amino-12,16-dimethylicosane-3,10,14,15-tetrol |
|---|---|
| PubChem CID | 165365457 |
| Molecular Formula | C22H47NO4 |
| Molecular Weight | 389.62 g/mol |
| Exact Mass | 389.35 |
| IUPAC Name | (2S,3S,10R,12S,14S,15R,16R)-2-amino-12,16-dimethylicosane-3,10,14,15-tetrol |
| SMILES | CCCC[C@@H](C)[C@@H](O)[C@@H](O)C[C@@H](C)C[C@H](O)CCCCCC[C@H](O)[C@H](C)N |
| InChI | InChI=1S/C22H47NO4/c1-5-6-11-17(3)22(27)21(26)15-16(2)14-19(24)12-9-7-8-10-13-20(25)18(4)23/h16-22,24-27H,5-15,23H2,1-4H3/t16-,17+,18-,19+,20-,21-,22+/m0/s1 |
| InChIKey | GYWXMRFVVQPVCP-FAGWYDQESA-N |
| XLogP | 3.36 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.62 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|