C12H18N2O6 — CID 21335617
2-[[3-(2-methylprop-2-enoylamino)propanoylamino]methyl]butanedioic acid (PubChem CID 21335617) has the molecular formula C12H18N2O6 and a molecular weight of 286.28 g/mol. Its IUPAC name is 2-[[3-(2-methylprop-2-enoylamino)propanoylamino]methyl]butanedioic acid.
| Compound Name | 2-[[3-(2-methylprop-2-enoylamino)propanoylamino]methyl]butanedioic acid |
|---|---|
| PubChem CID | 21335617 |
| Molecular Formula | C12H18N2O6 |
| Molecular Weight | 286.28 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | 2-[[3-(2-methylprop-2-enoylamino)propanoylamino]methyl]butanedioic acid |
| SMILES | C=C(C)C(=O)NCCC(=O)NCC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C12H18N2O6/c1-7(2)11(18)13-4-3-9(15)14-6-8(12(19)20)5-10(16)17/h8H,1,3-6H2,2H3,(H,13,18)(H,14,15)(H,16,17)(H,19,20) |
| InChIKey | DCQOHANJWWMGJP-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.28 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|