C14H20N2O6 — CID 91530019
4-(3-carboxypropylamino)-4-oxo-3-[(penta-2,4-dienoylamino)methyl]butanoic acid (PubChem CID 91530019) has the molecular formula C14H20N2O6 and a molecular weight of 312.32 g/mol. Its IUPAC name is 4-(3-carboxypropylamino)-4-oxo-3-[(penta-2,4-dienoylamino)methyl]butanoic acid.
| Compound Name | 4-(3-carboxypropylamino)-4-oxo-3-[(penta-2,4-dienoylamino)methyl]butanoic acid |
|---|---|
| PubChem CID | 91530019 |
| Molecular Formula | C14H20N2O6 |
| Molecular Weight | 312.32 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | 4-(3-carboxypropylamino)-4-oxo-3-[(penta-2,4-dienoylamino)methyl]butanoic acid |
| SMILES | C=CC=CC(=O)NCC(CC(=O)O)C(=O)NCCCC(=O)O |
| InChI | InChI=1S/C14H20N2O6/c1-2-3-5-11(17)16-9-10(8-13(20)21)14(22)15-7-4-6-12(18)19/h2-3,5,10H,1,4,6-9H2,(H,15,22)(H,16,17)(H,18,19)(H,20,21) |
| InChIKey | AHSZXTJDHRPZMB-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.32 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|