C26H34N2 — CID 21337637
1-(2,4,6-trimethylphenyl)-N-[2-[(2,4,6-trimethylphenyl)methylideneamino]cyclohexyl]methanimine (PubChem CID 21337637) has the molecular formula C26H34N2 and a molecular weight of 374.57 g/mol. Its IUPAC name is 1-(2,4,6-trimethylphenyl)-N-[2-[(2,4,6-trimethylphenyl)methylideneamino]cyclohexyl]methanimine.
| Compound Name | 1-(2,4,6-trimethylphenyl)-N-[2-[(2,4,6-trimethylphenyl)methylideneamino]cyclohexyl]methanimine |
|---|---|
| PubChem CID | 21337637 |
| Molecular Formula | C26H34N2 |
| Molecular Weight | 374.57 g/mol |
| Exact Mass | 374.27 |
| IUPAC Name | 1-(2,4,6-trimethylphenyl)-N-[2-[(2,4,6-trimethylphenyl)methylideneamino]cyclohexyl]methanimine |
| SMILES | Cc1cc(C)c(/C=N/C2CCCCC2/N=C/c2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C26H34N2/c1-17-11-19(3)23(20(4)12-17)15-27-25-9-7-8-10-26(25)28-16-24-21(5)13-18(2)14-22(24)6/h11-16,25-26H,7-10H2,1-6H3/b27-15+,28-16+ |
| InChIKey | QYQPZCXUUBVVSO-DPCVLPDWSA-N |
| XLogP | 6.39 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.57 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|