C44H59F2N — CID 143072020
4-(1,1-difluoroethyl)-1,2-dimethylbenzene;(2E,4E)-4-methyl-N-(3-methylidene-6-propylnonyl)-2,3-bis(4-methylphenyl)hexa-2,4-dien-1-imine (PubChem CID 143072020) has the molecular formula C44H59F2N and a molecular weight of 639.96 g/mol. Its IUPAC name is 4-(1,1-difluoroethyl)-1,2-dimethylbenzene;(2E,4E)-4-methyl-N-(3-methylidene-6-propylnonyl)-2,3-bis(4-methylphenyl)hexa-2,4-dien-1-imine.
| Compound Name | 4-(1,1-difluoroethyl)-1,2-dimethylbenzene;(2E,4E)-4-methyl-N-(3-methylidene-6-propylnonyl)-2,3-bis(4-methylphenyl)hexa-2,4-dien-1-imine |
|---|---|
| PubChem CID | 143072020 |
| Molecular Formula | C44H59F2N |
| Molecular Weight | 639.96 g/mol |
| Exact Mass | 639.46 |
| IUPAC Name | 4-(1,1-difluoroethyl)-1,2-dimethylbenzene;(2E,4E)-4-methyl-N-(3-methylidene-6-propylnonyl)-2,3-bis(4-methylphenyl)hexa-2,4-dien-1-imine |
| SMILES | C=C(CC/N=C/C(=C(C(\C)=C\C)/c1ccc(C)cc1)c1ccc(C)cc1)CCC(CCC)CCC.Cc1ccc(C(C)(F)F)cc1C |
| InChI | InChI=1S/C34H47N.C10H12F2/c1-8-11-30(12-9-2)18-13-28(6)23-24-35-25-33(31-19-14-26(4)15-20-31)34(29(7)10-3)32-21-16-27(5)17-22-32;1-7-4-5-9(6-8(7)2)10(3,11)12/h10,14-17,19-22,25,30H,6,8-9,11-13,18,23-24H2,1-5,7H3;4-6H,1-3H3/b29-10+,34-33-,35-25+; |
| InChIKey | WJQSDKDBWCIJOS-RKHQQFBGSA-N |
| XLogP | 13.61 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.96 |
| LogP ≤ 5 | 13.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|