About methyl 3-(4-methylbenzene-5-id-1-yl)-8-azabicyclo[3.2.1]octane-2-carboxylate;yttrium(3+)
methyl 3-(4-methylbenzene-5-id-1-yl)-8-azabicyclo[3.2.1]octane-2-carboxylate;yttrium(3+) (PubChem CID 21339675) has the molecular formula C16H20NO2Y+2
and a molecular weight of 347.25 g/mol. Its IUPAC name is methyl 3-(4-methylbenzene-5-id-1-yl)-8-azabicyclo[3.2.1]octane-2-carboxylate;yttrium(3+).
Molecular Properties
| Compound Name | methyl 3-(4-methylbenzene-5-id-1-yl)-8-azabicyclo[3.2.1]octane-2-carboxylate;yttrium(3+) |
| PubChem CID | 21339675 |
| Molecular Formula | C16H20NO2Y+2 |
| Molecular Weight | 347.25 g/mol |
| Exact Mass | 347.05 |
| IUPAC Name | methyl 3-(4-methylbenzene-5-id-1-yl)-8-azabicyclo[3.2.1]octane-2-carboxylate;yttrium(3+) |
| SMILES | COC(=O)C1C2CCC(CC1c1c[c-]c(C)cc1)N2.[Y+3] |
| InChI | InChI=1S/C16H20NO2.Y/c1-10-3-5-11(6-4-10)13-9-12-7-8-14(17-12)15(13)16(18)19-2;/h3,5-6,12-15,17H,7-9H2,1-2H3;/q-1;+3 |
| InChIKey | IHJQKPVWNSTRMW-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.25 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-(4-methylbenzene-5-id-1-yl)-8-azabicyclo[3.2.1]octane-2-carboxylate;yttrium(3+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-(4-methylbenzene-5-id-1-yl)-8-azabicyclo[3.2.1]octane-2-carboxylate;yttrium(3+)?
The IUPAC name of methyl 3-(4-methylbenzene-5-id-1-yl)-8-azabicyclo[3.2.1]octane-2-carboxylate;yttrium(3+) (CID 21339675) is methyl 3-(4-methylbenzene-5-id-1-yl)-8-azabicyclo[3.2.1]octane-2-carboxylate;yttrium(3+).
What is the SMILES notation for methyl 3-(4-methylbenzene-5-id-1-yl)-8-azabicyclo[3.2.1]octane-2-carboxylate;yttrium(3+)?
The canonical SMILES for methyl 3-(4-methylbenzene-5-id-1-yl)-8-azabicyclo[3.2.1]octane-2-carboxylate;yttrium(3+) is COC(=O)C1C2CCC(CC1c1c[c-]c(C)cc1)N2.[Y+3].
What is the InChIKey of methyl 3-(4-methylbenzene-5-id-1-yl)-8-azabicyclo[3.2.1]octane-2-carboxylate;yttrium(3+)?
The InChIKey is IHJQKPVWNSTRMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20NO2.Y/c1-10-3-5-11(6-4-10)13-9-12-7-8-14(17-12)15(13)16(18)19-2;/h3,5-6,12-15,17H,7-9H2,1-2H3;/q-1;+3.
What are the key properties of methyl 3-(4-methylbenzene-5-id-1-yl)-8-azabicyclo[3.2.1]octane-2-carboxylate;yttrium(3+)?
methyl 3-(4-methylbenzene-5-id-1-yl)-8-azabicyclo[3.2.1]octane-2-carboxylate;yttrium(3+) has a molecular weight of 347.25 g/mol, XLogP of 2.19, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(4-methylbenzene-5-id-1-yl)-8-azabicyclo[3.2.1]octane-2-carboxylate;yttrium(3+) is sourced from PubChem (CID 21339675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).