C18H23NO2 — CID 10469188
methyl (2S)-3-[4-[(E)-prop-1-enyl]phenyl]-8-azabicyclo[3.2.1]octane-2-carboxylate (PubChem CID 10469188) has the molecular formula C18H23NO2 and a molecular weight of 285.39 g/mol. Its IUPAC name is methyl (2S)-3-[4-[(E)-prop-1-enyl]phenyl]-8-azabicyclo[3.2.1]octane-2-carboxylate.
| Compound Name | methyl (2S)-3-[4-[(E)-prop-1-enyl]phenyl]-8-azabicyclo[3.2.1]octane-2-carboxylate |
|---|---|
| PubChem CID | 10469188 |
| Molecular Formula | C18H23NO2 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | methyl (2S)-3-[4-[(E)-prop-1-enyl]phenyl]-8-azabicyclo[3.2.1]octane-2-carboxylate |
| SMILES | C/C=C/c1ccc(C2CC3CCC(N3)[C@H]2C(=O)OC)cc1 |
| InChI | InChI=1S/C18H23NO2/c1-3-4-12-5-7-13(8-6-12)15-11-14-9-10-16(19-14)17(15)18(20)21-2/h3-8,14-17,19H,9-11H2,1-2H3/b4-3+/t14?,15?,16?,17-/m0/s1 |
| InChIKey | FDUTVICQIUOONG-GJQNMSFVSA-N |
| XLogP | 3.12 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |