C14H18O5 — CID 21342029
5-methyl-6-oxo-3,4,4a,5,7,8,9,10a-octahydro-2H-pyrano[2,3-b]chromene-8-carboxylic acid (PubChem CID 21342029) has the molecular formula C14H18O5 and a molecular weight of 266.29 g/mol. Its IUPAC name is 5-methyl-6-oxo-3,4,4a,5,7,8,9,10a-octahydro-2H-pyrano[2,3-b]chromene-8-carboxylic acid.
| Compound Name | 5-methyl-6-oxo-3,4,4a,5,7,8,9,10a-octahydro-2H-pyrano[2,3-b]chromene-8-carboxylic acid |
|---|---|
| PubChem CID | 21342029 |
| Molecular Formula | C14H18O5 |
| Molecular Weight | 266.29 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | 5-methyl-6-oxo-3,4,4a,5,7,8,9,10a-octahydro-2H-pyrano[2,3-b]chromene-8-carboxylic acid |
| SMILES | CC1C2=C(CC(C(=O)O)CC2=O)OC2OCCCC21 |
| InChI | InChI=1S/C14H18O5/c1-7-9-3-2-4-18-14(9)19-11-6-8(13(16)17)5-10(15)12(7)11/h7-9,14H,2-6H2,1H3,(H,16,17) |
| InChIKey | CPPWCOFVYZTFBW-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.29 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |