C20H32O5 — CID 11110953
4-hexyl-2-[(2-methylpropan-2-yl)oxy]-5-oxo-2,3,4,6,7,8-hexahydrochromene-7-carboxylic acid (PubChem CID 11110953) has the molecular formula C20H32O5 and a molecular weight of 352.47 g/mol. Its IUPAC name is 4-hexyl-2-[(2-methylpropan-2-yl)oxy]-5-oxo-2,3,4,6,7,8-hexahydrochromene-7-carboxylic acid.
| Compound Name | 4-hexyl-2-[(2-methylpropan-2-yl)oxy]-5-oxo-2,3,4,6,7,8-hexahydrochromene-7-carboxylic acid |
|---|---|
| PubChem CID | 11110953 |
| Molecular Formula | C20H32O5 |
| Molecular Weight | 352.47 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | 4-hexyl-2-[(2-methylpropan-2-yl)oxy]-5-oxo-2,3,4,6,7,8-hexahydrochromene-7-carboxylic acid |
| SMILES | CCCCCCC1CC(OC(C)(C)C)OC2=C1C(=O)CC(C(=O)O)C2 |
| InChI | InChI=1S/C20H32O5/c1-5-6-7-8-9-13-12-17(25-20(2,3)4)24-16-11-14(19(22)23)10-15(21)18(13)16/h13-14,17H,5-12H2,1-4H3,(H,22,23) |
| InChIKey | GSFBWZXWWREALL-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.47 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|