C16H20O7 — CID 101136221
[(2R,3R,8R)-2-acetyloxy-8-ethyl-4,5-dioxo-3,6,7,8-tetrahydro-2H-chromen-3-yl]methyl acetate (PubChem CID 101136221) has the molecular formula C16H20O7 and a molecular weight of 324.33 g/mol. Its IUPAC name is [(2R,3R,8R)-2-acetyloxy-8-ethyl-4,5-dioxo-3,6,7,8-tetrahydro-2H-chromen-3-yl]methyl acetate.
| Compound Name | [(2R,3R,8R)-2-acetyloxy-8-ethyl-4,5-dioxo-3,6,7,8-tetrahydro-2H-chromen-3-yl]methyl acetate |
|---|---|
| PubChem CID | 101136221 |
| Molecular Formula | C16H20O7 |
| Molecular Weight | 324.33 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | [(2R,3R,8R)-2-acetyloxy-8-ethyl-4,5-dioxo-3,6,7,8-tetrahydro-2H-chromen-3-yl]methyl acetate |
| SMILES | CC[C@@H]1CCC(=O)C2=C1O[C@H](OC(C)=O)[C@@H](COC(C)=O)C2=O |
| InChI | InChI=1S/C16H20O7/c1-4-10-5-6-12(19)13-14(20)11(7-21-8(2)17)16(22-9(3)18)23-15(10)13/h10-11,16H,4-7H2,1-3H3/t10-,11+,16+/m1/s1 |
| InChIKey | IBSDRRNYCCLOSW-GDLVEWKHSA-N |
| XLogP | 1.30 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.33 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|