C14H22O3 — CID 90112681
2-ethoxy-4-propyl-2,3,4,6,7,8-hexahydrochromen-5-one (PubChem CID 90112681) has the molecular formula C14H22O3 and a molecular weight of 238.33 g/mol. Its IUPAC name is 2-ethoxy-4-propyl-2,3,4,6,7,8-hexahydrochromen-5-one.
| Compound Name | 2-ethoxy-4-propyl-2,3,4,6,7,8-hexahydrochromen-5-one |
|---|---|
| PubChem CID | 90112681 |
| Molecular Formula | C14H22O3 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.16 |
| IUPAC Name | 2-ethoxy-4-propyl-2,3,4,6,7,8-hexahydrochromen-5-one |
| SMILES | CCCC1CC(OCC)OC2=C1C(=O)CCC2 |
| InChI | InChI=1S/C14H22O3/c1-3-6-10-9-13(16-4-2)17-12-8-5-7-11(15)14(10)12/h10,13H,3-9H2,1-2H3 |
| InChIKey | WWNDYQABJKXPMJ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |