C12H16O3 — CID 139093736
(4aR,10aS)-3,4,4a,5,7,8,9,10a-octahydro-2H-pyrano[2,3-b]chromen-6-one (PubChem CID 139093736) has the molecular formula C12H16O3 and a molecular weight of 208.26 g/mol. Its IUPAC name is (4aR,10aS)-3,4,4a,5,7,8,9,10a-octahydro-2H-pyrano[2,3-b]chromen-6-one.
| Compound Name | (4aR,10aS)-3,4,4a,5,7,8,9,10a-octahydro-2H-pyrano[2,3-b]chromen-6-one |
|---|---|
| PubChem CID | 139093736 |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | (4aR,10aS)-3,4,4a,5,7,8,9,10a-octahydro-2H-pyrano[2,3-b]chromen-6-one |
| SMILES | O=C1CCCC2=C1C[C@H]1CCCO[C@H]1O2 |
| InChI | InChI=1S/C12H16O3/c13-10-4-1-5-11-9(10)7-8-3-2-6-14-12(8)15-11/h8,12H,1-7H2/t8-,12+/m1/s1 |
| InChIKey | NMFGGSRKXOJWPE-PELKAZGASA-N |
| XLogP | 2.17 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |