C17H28O3 — CID 102454113
(3R)-3-hexyl-2-hydroxy-7,7-dimethyl-3,4,6,8-tetrahydro-2H-chromen-5-one (PubChem CID 102454113) has the molecular formula C17H28O3 and a molecular weight of 280.41 g/mol. Its IUPAC name is (3R)-3-hexyl-2-hydroxy-7,7-dimethyl-3,4,6,8-tetrahydro-2H-chromen-5-one.
| Compound Name | (3R)-3-hexyl-2-hydroxy-7,7-dimethyl-3,4,6,8-tetrahydro-2H-chromen-5-one |
|---|---|
| PubChem CID | 102454113 |
| Molecular Formula | C17H28O3 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | (3R)-3-hexyl-2-hydroxy-7,7-dimethyl-3,4,6,8-tetrahydro-2H-chromen-5-one |
| SMILES | CCCCCC[C@@H]1CC2=C(CC(C)(C)CC2=O)OC1O |
| InChI | InChI=1S/C17H28O3/c1-4-5-6-7-8-12-9-13-14(18)10-17(2,3)11-15(13)20-16(12)19/h12,16,19H,4-11H2,1-3H3/t12-,16?/m1/s1 |
| InChIKey | LFHCFOKPWNBOBF-ZGTOLYCTSA-N |
| XLogP | 3.95 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|