C21H36O3 — CID 102396316
(4R)-4-decyl-2-hydroxy-7,7-dimethyl-3,4,6,8-tetrahydro-2H-chromen-5-one (PubChem CID 102396316) has the molecular formula C21H36O3 and a molecular weight of 336.52 g/mol. Its IUPAC name is (4R)-4-decyl-2-hydroxy-7,7-dimethyl-3,4,6,8-tetrahydro-2H-chromen-5-one.
| Compound Name | (4R)-4-decyl-2-hydroxy-7,7-dimethyl-3,4,6,8-tetrahydro-2H-chromen-5-one |
|---|---|
| PubChem CID | 102396316 |
| Molecular Formula | C21H36O3 |
| Molecular Weight | 336.52 g/mol |
| Exact Mass | 336.27 |
| IUPAC Name | (4R)-4-decyl-2-hydroxy-7,7-dimethyl-3,4,6,8-tetrahydro-2H-chromen-5-one |
| SMILES | CCCCCCCCCC[C@@H]1CC(O)OC2=C1C(=O)CC(C)(C)C2 |
| InChI | InChI=1S/C21H36O3/c1-4-5-6-7-8-9-10-11-12-16-13-19(23)24-18-15-21(2,3)14-17(22)20(16)18/h16,19,23H,4-15H2,1-3H3/t16-,19?/m1/s1 |
| InChIKey | JOAHEGXZFUERHD-VTBWFHPJSA-N |
| XLogP | 5.52 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.52 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|