C38H31N2Si+ — CID 21342169
(1,3-diphenyl-2H-quinazolin-3-ium-8-yl)-triphenylsilane (PubChem CID 21342169) has the molecular formula C38H31N2Si+ and a molecular weight of 543.77 g/mol. Its IUPAC name is (1,3-diphenyl-2H-quinazolin-3-ium-8-yl)-triphenylsilane.
| Compound Name | (1,3-diphenyl-2H-quinazolin-3-ium-8-yl)-triphenylsilane |
|---|---|
| PubChem CID | 21342169 |
| Molecular Formula | C38H31N2Si+ |
| Molecular Weight | 543.77 g/mol |
| Exact Mass | 543.23 |
| IUPAC Name | (1,3-diphenyl-2H-quinazolin-3-ium-8-yl)-triphenylsilane |
| SMILES | C1=[N+](c2ccccc2)CN(c2ccccc2)c2c1cccc2[Si](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C38H31N2Si/c1-6-18-32(19-7-1)39-29-31-17-16-28-37(38(31)40(30-39)33-20-8-2-9-21-33)41(34-22-10-3-11-23-34,35-24-12-4-13-25-35)36-26-14-5-15-27-36/h1-29H,30H2/q+1 |
| InChIKey | CRDYOYWCKCZOTG-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.77 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|