C32H26NOSi+ — CID 22968880
triphenyl-(3-phenyl-2H-1,3-benzoxazin-3-ium-8-yl)silane (PubChem CID 22968880) has the molecular formula C32H26NOSi+ and a molecular weight of 468.65 g/mol. Its IUPAC name is triphenyl-(3-phenyl-2H-1,3-benzoxazin-3-ium-8-yl)silane.
| Compound Name | triphenyl-(3-phenyl-2H-1,3-benzoxazin-3-ium-8-yl)silane |
|---|---|
| PubChem CID | 22968880 |
| Molecular Formula | C32H26NOSi+ |
| Molecular Weight | 468.65 g/mol |
| Exact Mass | 468.18 |
| IUPAC Name | triphenyl-(3-phenyl-2H-1,3-benzoxazin-3-ium-8-yl)silane |
| SMILES | C1=[N+](c2ccccc2)COc2c1cccc2[Si](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C32H26NOSi/c1-5-15-27(16-6-1)33-24-26-14-13-23-31(32(26)34-25-33)35(28-17-7-2-8-18-28,29-19-9-3-10-20-29)30-21-11-4-12-22-30/h1-24H,25H2/q+1 |
| InChIKey | HUAZYLYTVGHGAE-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 12.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.65 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|