C16H16NO2+ — CID 22968135
3-(4-methoxyphenyl)-8-methyl-2H-1,3-benzoxazin-3-ium (PubChem CID 22968135) has the molecular formula C16H16NO2+ and a molecular weight of 254.31 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-8-methyl-2H-1,3-benzoxazin-3-ium.
| Compound Name | 3-(4-methoxyphenyl)-8-methyl-2H-1,3-benzoxazin-3-ium |
|---|---|
| PubChem CID | 22968135 |
| Molecular Formula | C16H16NO2+ |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | 3-(4-methoxyphenyl)-8-methyl-2H-1,3-benzoxazin-3-ium |
| SMILES | COc1ccc([N+]2=Cc3cccc(C)c3OC2)cc1 |
| InChI | InChI=1S/C16H16NO2/c1-12-4-3-5-13-10-17(11-19-16(12)13)14-6-8-15(18-2)9-7-14/h3-10H,11H2,1-2H3/q+1 |
| InChIKey | RIWUVWPDNQKQDN-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 21.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|